C9H8ClNS — CID 2315866
5-(chloromethyl)-2-methyl-1,3-benzothiazole (PubChem CID 2315866) has the molecular formula C9H8ClNS and a molecular weight of 197.69 g/mol. Its IUPAC name is 5-(chloromethyl)-2-methyl-1,3-benzothiazole.
| Compound Name | 5-(chloromethyl)-2-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 2315866 |
| Molecular Formula | C9H8ClNS |
| Molecular Weight | 197.69 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 5-(chloromethyl)-2-methyl-1,3-benzothiazole |
| SMILES | Cc1nc2cc(CCl)ccc2s1 |
| InChI | InChI=1S/C9H8ClNS/c1-6-11-8-4-7(5-10)2-3-9(8)12-6/h2-4H,5H2,1H3 |
| InChIKey | QZFLAUOKNXRSMY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.69 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|