C9H9NS2 — CID 10954473
2-methyl-5-methylsulfanyl-1,3-benzothiazole (PubChem CID 10954473) has the molecular formula C9H9NS2 and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-methyl-5-methylsulfanyl-1,3-benzothiazole.
| Compound Name | 2-methyl-5-methylsulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 10954473 |
| Molecular Formula | C9H9NS2 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | 2-methyl-5-methylsulfanyl-1,3-benzothiazole |
| SMILES | CSc1ccc2sc(C)nc2c1 |
| InChI | InChI=1S/C9H9NS2/c1-6-10-8-5-7(11-2)3-4-9(8)12-6/h3-5H,1-2H3 |
| InChIKey | DKCBZKUWJRXHQW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |