C12H9N3OS — CID 138807740
2-methyl-5-pyrimidin-5-yloxy-1,3-benzothiazole (PubChem CID 138807740) has the molecular formula C12H9N3OS and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-methyl-5-pyrimidin-5-yloxy-1,3-benzothiazole.
| Compound Name | 2-methyl-5-pyrimidin-5-yloxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 138807740 |
| Molecular Formula | C12H9N3OS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-methyl-5-pyrimidin-5-yloxy-1,3-benzothiazole |
| SMILES | Cc1nc2cc(Oc3cncnc3)ccc2s1 |
| InChI | InChI=1S/C12H9N3OS/c1-8-15-11-4-9(2-3-12(11)17-8)16-10-5-13-7-14-6-10/h2-7H,1H3 |
| InChIKey | SFZKARUKWLTPSG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |