C8H6NNaO2S3 — CID 58683337
sodium 2-methyl-5-sulfidosulfinyloxy-1,3-benzothiazole (PubChem CID 58683337) has the molecular formula C8H6NNaO2S3 and a molecular weight of 267.33 g/mol. Its IUPAC name is sodium 2-methyl-5-sulfidosulfinyloxy-1,3-benzothiazole.
| Compound Name | sodium 2-methyl-5-sulfidosulfinyloxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 58683337 |
| Molecular Formula | C8H6NNaO2S3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 266.95 |
| IUPAC Name | sodium 2-methyl-5-sulfidosulfinyloxy-1,3-benzothiazole |
| SMILES | Cc1nc2cc(OS(=O)[S-])ccc2s1.[Na+] |
| InChI | InChI=1S/C8H7NO2S3.Na/c1-5-9-7-4-6(11-14(10)12)2-3-8(7)13-5;/h2-4H,1H3,(H,10,12);/q;+1/p-1 |
| InChIKey | FKQKXSOIUGWGTD-UHFFFAOYSA-M |
| XLogP | -0.89 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|