C16H21NO3S — CID 177166236
ethyl 6-[(2-methyl-1,3-benzothiazol-5-yl)oxy]hexanoate (PubChem CID 177166236) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is ethyl 6-[(2-methyl-1,3-benzothiazol-5-yl)oxy]hexanoate.
| Compound Name | ethyl 6-[(2-methyl-1,3-benzothiazol-5-yl)oxy]hexanoate |
|---|---|
| PubChem CID | 177166236 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | ethyl 6-[(2-methyl-1,3-benzothiazol-5-yl)oxy]hexanoate |
| SMILES | CCOC(=O)CCCCCOc1ccc2sc(C)nc2c1 |
| InChI | InChI=1S/C16H21NO3S/c1-3-19-16(18)7-5-4-6-10-20-13-8-9-15-14(11-13)17-12(2)21-15/h8-9,11H,3-7,10H2,1-2H3 |
| InChIKey | SICNTSIQAKHOGU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|