C17H20N4O3S — CID 22054962
1-[2-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxy]pentyl]imidazole-4-carboxamide (PubChem CID 22054962) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 1-[2-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxy]pentyl]imidazole-4-carboxamide.
| Compound Name | 1-[2-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxy]pentyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 22054962 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-[2-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxy]pentyl]imidazole-4-carboxamide |
| SMILES | Cc1nc2cc(OCCCC(O)Cn3cnc(C(N)=O)c3)ccc2s1 |
| InChI | InChI=1S/C17H20N4O3S/c1-11-20-14-7-13(4-5-16(14)25-11)24-6-2-3-12(22)8-21-9-15(17(18)23)19-10-21/h4-5,7,9-10,12,22H,2-3,6,8H2,1H3,(H2,18,23) |
| InChIKey | UQHHYMOYUXSXPS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|