C27H35N3O6S — CID 11489435
2-[4-[4-[4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]butoxy]phenoxy]acetic acid (PubChem CID 11489435) has the molecular formula C27H35N3O6S and a molecular weight of 529.66 g/mol. Its IUPAC name is 2-[4-[4-[4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]butoxy]phenoxy]acetic acid.
| Compound Name | 2-[4-[4-[4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]butoxy]phenoxy]acetic acid |
|---|---|
| PubChem CID | 11489435 |
| Molecular Formula | C27H35N3O6S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | 2-[4-[4-[4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]butoxy]phenoxy]acetic acid |
| SMILES | Cc1nc2cc(OC[C@H](O)CN3CCN(CCCCOc4ccc(OCC(=O)O)cc4)CC3)ccc2s1 |
| InChI | InChI=1S/C27H35N3O6S/c1-20-28-25-16-24(8-9-26(25)37-20)35-18-21(31)17-30-13-11-29(12-14-30)10-2-3-15-34-22-4-6-23(7-5-22)36-19-27(32)33/h4-9,16,21,31H,2-3,10-15,17-19H2,1H3,(H,32,33)/t21-/m1/s1 |
| InChIKey | AVKGTRLAKUPION-OAQYLSRUSA-N |
| XLogP | 3.28 |
| TPSA | 104.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|