C25H28N4O4S — CID 21060622
2-[2-[4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 21060622) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is 2-[2-[4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21060622 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 2-[2-[4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | Cc1nc2cc(OC[C@H](O)CN3CCN(CCN4C(=O)c5ccccc5C4=O)CC3)ccc2s1 |
| InChI | InChI=1S/C25H28N4O4S/c1-17-26-22-14-19(6-7-23(22)34-17)33-16-18(30)15-28-10-8-27(9-11-28)12-13-29-24(31)20-4-2-3-5-21(20)25(29)32/h2-7,14,18,30H,8-13,15-16H2,1H3/t18-/m1/s1 |
| InChIKey | DTNIWBZGAJTZNE-GOSISDBHSA-N |
| XLogP | 2.26 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|