C23H30N4O4S2 — CID 69008465
(2R)-1-[4-[2-(2-aminophenyl)sulfonylethyl]piperazin-1-yl]-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propan-2-ol (PubChem CID 69008465) has the molecular formula C23H30N4O4S2 and a molecular weight of 490.65 g/mol. Its IUPAC name is (2R)-1-[4-[2-(2-aminophenyl)sulfonylethyl]piperazin-1-yl]-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propan-2-ol.
| Compound Name | (2R)-1-[4-[2-(2-aminophenyl)sulfonylethyl]piperazin-1-yl]-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 69008465 |
| Molecular Formula | C23H30N4O4S2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | (2R)-1-[4-[2-(2-aminophenyl)sulfonylethyl]piperazin-1-yl]-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propan-2-ol |
| SMILES | Cc1nc2cc(OC[C@H](O)CN3CCN(CCS(=O)(=O)c4ccccc4N)CC3)ccc2s1 |
| InChI | InChI=1S/C23H30N4O4S2/c1-17-25-21-14-19(6-7-22(21)32-17)31-16-18(28)15-27-10-8-26(9-11-27)12-13-33(29,30)23-5-3-2-4-20(23)24/h2-7,14,18,28H,8-13,15-16,24H2,1H3/t18-/m1/s1 |
| InChIKey | AXFMSAYCYDKGBA-GOSISDBHSA-N |
| XLogP | 2.02 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|