C22H25ClN4O2S2 — CID 11431505
N-(2-chlorophenyl)-4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazine-1-carbothioamide (PubChem CID 11431505) has the molecular formula C22H25ClN4O2S2 and a molecular weight of 477.06 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazine-1-carbothioamide.
| Compound Name | N-(2-chlorophenyl)-4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 11431505 |
| Molecular Formula | C22H25ClN4O2S2 |
| Molecular Weight | 477.06 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | N-(2-chlorophenyl)-4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazine-1-carbothioamide |
| SMILES | Cc1nc2cc(OC[C@H](O)CN3CCN(C(=S)Nc4ccccc4Cl)CC3)ccc2s1 |
| InChI | InChI=1S/C22H25ClN4O2S2/c1-15-24-20-12-17(6-7-21(20)31-15)29-14-16(28)13-26-8-10-27(11-9-26)22(30)25-19-5-3-2-4-18(19)23/h2-7,12,16,28H,8-11,13-14H2,1H3,(H,25,30)/t16-/m1/s1 |
| InChIKey | ARSGTOLCFNFELG-MRXNPFEDSA-N |
| XLogP | 4.01 |
| TPSA | 60.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.06 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|