C23H28N4O4S — CID 10276097
2-[4-[2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 10276097) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is 2-[4-[2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[4-[2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 10276097 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-[4-[2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | Cc1nc2cc(OCC(O)CN3CCN(CC(=O)Nc4ccc(O)cc4)CC3)ccc2s1 |
| InChI | InChI=1S/C23H28N4O4S/c1-16-24-21-12-20(6-7-22(21)32-16)31-15-19(29)13-26-8-10-27(11-9-26)14-23(30)25-17-2-4-18(28)5-3-17/h2-7,12,19,28-29H,8-11,13-15H2,1H3,(H,25,30) |
| InChIKey | RYTNTASXQAZPTK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|