C21H26N4O5S — CID 87956215
2-(1,2-dioxin-3-yl)-2-[4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]acetamide (PubChem CID 87956215) has the molecular formula C21H26N4O5S and a molecular weight of 446.53 g/mol. Its IUPAC name is 2-(1,2-dioxin-3-yl)-2-[4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]acetamide.
| Compound Name | 2-(1,2-dioxin-3-yl)-2-[4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 87956215 |
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-(1,2-dioxin-3-yl)-2-[4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]acetamide |
| SMILES | Cc1nc2cc(OC[C@H](O)CN3CCN(C(C(N)=O)C4=CC=COO4)CC3)ccc2s1 |
| InChI | InChI=1S/C21H26N4O5S/c1-14-23-17-11-16(4-5-19(17)31-14)28-13-15(26)12-24-6-8-25(9-7-24)20(21(22)27)18-3-2-10-29-30-18/h2-5,10-11,15,20,26H,6-9,12-13H2,1H3,(H2,22,27)/t15-,20?/m1/s1 |
| InChIKey | XGKXLKXQXWMSTD-IWPPFLRJSA-N |
| XLogP | 1.18 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|