C23H27FN4O3S2 — CID 87824752
[(4-fluorophenyl)-[4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]methyl]carbamothioic S-acid (PubChem CID 87824752) has the molecular formula C23H27FN4O3S2 and a molecular weight of 490.63 g/mol. Its IUPAC name is [(4-fluorophenyl)-[4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]methyl]carbamothioic S-acid.
| Compound Name | [(4-fluorophenyl)-[4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]methyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 87824752 |
| Molecular Formula | C23H27FN4O3S2 |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | [(4-fluorophenyl)-[4-[(2R)-2-hydroxy-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propyl]piperazin-1-yl]methyl]carbamothioic S-acid |
| SMILES | Cc1nc2cc(OC[C@H](O)CN3CCN(C(NC(=O)S)c4ccc(F)cc4)CC3)ccc2s1 |
| InChI | InChI=1S/C23H27FN4O3S2/c1-15-25-20-12-19(6-7-21(20)33-15)31-14-18(29)13-27-8-10-28(11-9-27)22(26-23(30)32)16-2-4-17(24)5-3-16/h2-7,12,18,22,29H,8-11,13-14H2,1H3,(H2,26,30,32)/t18-,22?/m1/s1 |
| InChIKey | NCLDNUHRLAQSSL-ZZWBGTBQSA-N |
| XLogP | 3.44 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|