C21H22FN3O3 — CID 22055006
1-[5-[3-(4-fluorophenyl)phenoxy]-2-hydroxypentyl]imidazole-4-carboxamide (PubChem CID 22055006) has the molecular formula C21H22FN3O3 and a molecular weight of 383.42 g/mol. Its IUPAC name is 1-[5-[3-(4-fluorophenyl)phenoxy]-2-hydroxypentyl]imidazole-4-carboxamide.
| Compound Name | 1-[5-[3-(4-fluorophenyl)phenoxy]-2-hydroxypentyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 22055006 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 1-[5-[3-(4-fluorophenyl)phenoxy]-2-hydroxypentyl]imidazole-4-carboxamide |
| SMILES | NC(=O)c1cn(CC(O)CCCOc2cccc(-c3ccc(F)cc3)c2)cn1 |
| InChI | InChI=1S/C21H22FN3O3/c22-17-8-6-15(7-9-17)16-3-1-5-19(11-16)28-10-2-4-18(26)12-25-13-20(21(23)27)24-14-25/h1,3,5-9,11,13-14,18,26H,2,4,10,12H2,(H2,23,27) |
| InChIKey | OSUTZCVOGUUISU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|