C26H35ClN4O3Si — CID 22054971
1-[2-[tert-butyl(dimethyl)silyl]oxy-5-[3-(6-chloro-3-pyridinyl)phenoxy]pentyl]imidazole-4-carboxamide (PubChem CID 22054971) has the molecular formula C26H35ClN4O3Si and a molecular weight of 515.13 g/mol. Its IUPAC name is 1-[2-[tert-butyl(dimethyl)silyl]oxy-5-[3-(6-chloro-3-pyridinyl)phenoxy]pentyl]imidazole-4-carboxamide.
| Compound Name | 1-[2-[tert-butyl(dimethyl)silyl]oxy-5-[3-(6-chloro-3-pyridinyl)phenoxy]pentyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 22054971 |
| Molecular Formula | C26H35ClN4O3Si |
| Molecular Weight | 515.13 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 1-[2-[tert-butyl(dimethyl)silyl]oxy-5-[3-(6-chloro-3-pyridinyl)phenoxy]pentyl]imidazole-4-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCCOc1cccc(-c2ccc(Cl)nc2)c1)Cn1cnc(C(N)=O)c1 |
| InChI | InChI=1S/C26H35ClN4O3Si/c1-26(2,3)35(4,5)34-22(16-31-17-23(25(28)32)30-18-31)10-7-13-33-21-9-6-8-19(14-21)20-11-12-24(27)29-15-20/h6,8-9,11-12,14-15,17-18,22H,7,10,13,16H2,1-5H3,(H2,28,32) |
| InChIKey | BXSBGBXXNDYDHN-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.13 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|