C23H37N3O3Si — CID 10274400
1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-(3,4-dimethylphenoxy)pentan-3-yl]imidazole-4-carboxamide (PubChem CID 10274400) has the molecular formula C23H37N3O3Si and a molecular weight of 431.65 g/mol. Its IUPAC name is 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-(3,4-dimethylphenoxy)pentan-3-yl]imidazole-4-carboxamide.
| Compound Name | 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-(3,4-dimethylphenoxy)pentan-3-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 10274400 |
| Molecular Formula | C23H37N3O3Si |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 1-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-(3,4-dimethylphenoxy)pentan-3-yl]imidazole-4-carboxamide |
| SMILES | Cc1ccc(OCC[C@H]([C@H](C)O[Si](C)(C)C(C)(C)C)n2cnc(C(N)=O)c2)cc1C |
| InChI | InChI=1S/C23H37N3O3Si/c1-16-9-10-19(13-17(16)2)28-12-11-21(26-14-20(22(24)27)25-15-26)18(3)29-30(7,8)23(4,5)6/h9-10,13-15,18,21H,11-12H2,1-8H3,(H2,24,27)/t18-,21+/m0/s1 |
| InChIKey | DSOJRTGXHSXNBH-GHTZIAJQSA-N |
| XLogP | 5.02 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|