C28H35ClN4O3Si — CID 69104053
1-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]pentyl]imidazole-4-carboxamide (PubChem CID 69104053) has the molecular formula C28H35ClN4O3Si and a molecular weight of 539.15 g/mol. Its IUPAC name is 1-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]pentyl]imidazole-4-carboxamide.
| Compound Name | 1-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]pentyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 69104053 |
| Molecular Formula | C28H35ClN4O3Si |
| Molecular Weight | 539.15 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 1-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]pentyl]imidazole-4-carboxamide |
| SMILES | C[C@@H](CCC(c1ccc2oc(-c3ccc(Cl)cc3)nc2c1)n1cnc(C(N)=O)c1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H35ClN4O3Si/c1-18(36-37(5,6)28(2,3)4)7-13-24(33-16-23(26(30)34)31-17-33)20-10-14-25-22(15-20)32-27(35-25)19-8-11-21(29)12-9-19/h8-12,14-18,24H,7,13H2,1-6H3,(H2,30,34)/t18-,24?/m0/s1 |
| InChIKey | WIUWYWJAEQHJLE-VEXWJQHLSA-N |
| XLogP | 7.22 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.15 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|