C16H12ClKNO3 — CID 170846881
CID 170846881 (PubChem CID 170846881) has the molecular formula C16H12ClKNO3 and a molecular weight of 340.83 g/mol.
| Compound Name | CID 170846881 |
|---|---|
| PubChem CID | 170846881 |
| Molecular Formula | C16H12ClKNO3 |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | — |
| SMILES | CC(C(=O)O)c1ccc2oc(-c3ccc(Cl)cc3)nc2c1.[K] |
| InChI | InChI=1S/C16H12ClNO3.K/c1-9(16(19)20)11-4-7-14-13(8-11)18-15(21-14)10-2-5-12(17)6-3-10;/h2-9H,1H3,(H,19,20); |
| InChIKey | MBDNKRSJUXEGPQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |