C17H15NO3 — CID 125495241
(2R)-2-[2-(3-methylphenyl)-1,3-benzoxazol-6-yl]propanoic acid (PubChem CID 125495241) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is (2R)-2-[2-(3-methylphenyl)-1,3-benzoxazol-6-yl]propanoic acid.
| Compound Name | (2R)-2-[2-(3-methylphenyl)-1,3-benzoxazol-6-yl]propanoic acid |
|---|---|
| PubChem CID | 125495241 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (2R)-2-[2-(3-methylphenyl)-1,3-benzoxazol-6-yl]propanoic acid |
| SMILES | Cc1cccc(-c2nc3ccc([C@@H](C)C(=O)O)cc3o2)c1 |
| InChI | InChI=1S/C17H15NO3/c1-10-4-3-5-13(8-10)16-18-14-7-6-12(9-15(14)21-16)11(2)17(19)20/h3-9,11H,1-2H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | QTSKWJBNGIAKQW-LLVKDONJSA-N |
| XLogP | 3.99 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |