C22H27NO4 — CID 143910344
heptan-1-ol;3-(6-methyl-1,3-benzoxazol-2-yl)benzoic acid (PubChem CID 143910344) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is heptan-1-ol;3-(6-methyl-1,3-benzoxazol-2-yl)benzoic acid.
| Compound Name | heptan-1-ol;3-(6-methyl-1,3-benzoxazol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 143910344 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | heptan-1-ol;3-(6-methyl-1,3-benzoxazol-2-yl)benzoic acid |
| SMILES | CCCCCCCO.Cc1ccc2nc(-c3cccc(C(=O)O)c3)oc2c1 |
| InChI | InChI=1S/C15H11NO3.C7H16O/c1-9-5-6-12-13(7-9)19-14(16-12)10-3-2-4-11(8-10)15(17)18;1-2-3-4-5-6-7-8/h2-8H,1H3,(H,17,18);8H,2-7H2,1H3 |
| InChIKey | XNGIRRKQWHMLMV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|