C14H16N2O3 — CID 63382298
3-(5-pentyl-1,3,4-oxadiazol-2-yl)benzoic acid (PubChem CID 63382298) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-(5-pentyl-1,3,4-oxadiazol-2-yl)benzoic acid.
| Compound Name | 3-(5-pentyl-1,3,4-oxadiazol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 63382298 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-(5-pentyl-1,3,4-oxadiazol-2-yl)benzoic acid |
| SMILES | CCCCCc1nnc(-c2cccc(C(=O)O)c2)o1 |
| InChI | InChI=1S/C14H16N2O3/c1-2-3-4-8-12-15-16-13(19-12)10-6-5-7-11(9-10)14(17)18/h5-7,9H,2-4,8H2,1H3,(H,17,18) |
| InChIKey | YLPYJKRZPHSIAW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|