C18H16N2O4S — CID 21108692
3-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzoic acid (PubChem CID 21108692) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is 3-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzoic acid.
| Compound Name | 3-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 21108692 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 3-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2nnc(CSCCOc3ccccc3)o2)c1 |
| InChI | InChI=1S/C18H16N2O4S/c21-18(22)14-6-4-5-13(11-14)17-20-19-16(24-17)12-25-10-9-23-15-7-2-1-3-8-15/h1-8,11H,9-10,12H2,(H,21,22) |
| InChIKey | WAWJCGOXPBWWCI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|