C23H28N4O3S — CID 21108966
N-[3-(dimethylamino)propyl]-3-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 21108966) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-3-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-3-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 21108966 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-3-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1cccc(-c2nnc(CSCCOc3ccccc3)o2)c1 |
| InChI | InChI=1S/C23H28N4O3S/c1-27(2)13-7-12-24-22(28)18-8-6-9-19(16-18)23-26-25-21(30-23)17-31-15-14-29-20-10-4-3-5-11-20/h3-6,8-11,16H,7,12-15,17H2,1-2H3,(H,24,28) |
| InChIKey | BSZQMRKIOCCXMA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|