C25H30N4O4S — CID 21109000
N-(3-morpholin-4-ylpropyl)-4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 21109000) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 21109000 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | O=C(NCCCN1CCOCC1)c1ccc(-c2nnc(CSCCOc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C25H30N4O4S/c30-24(26-11-4-12-29-13-15-31-16-14-29)20-7-9-21(10-8-20)25-28-27-23(33-25)19-34-18-17-32-22-5-2-1-3-6-22/h1-3,5-10H,4,11-19H2,(H,26,30) |
| InChIKey | JDGJXHCNSCVJIQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|