C29H32N4O3S — CID 21108997
N-[3-(N-ethylanilino)propyl]-4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 21108997) has the molecular formula C29H32N4O3S and a molecular weight of 516.67 g/mol. Its IUPAC name is N-[3-(N-ethylanilino)propyl]-4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | N-[3-(N-ethylanilino)propyl]-4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 21108997 |
| Molecular Formula | C29H32N4O3S |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | N-[3-(N-ethylanilino)propyl]-4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | CCN(CCCNC(=O)c1ccc(-c2nnc(CSCCOc3ccccc3)o2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H32N4O3S/c1-2-33(25-10-5-3-6-11-25)19-9-18-30-28(34)23-14-16-24(17-15-23)29-32-31-27(36-29)22-37-21-20-35-26-12-7-4-8-13-26/h3-8,10-17H,2,9,18-22H2,1H3,(H,30,34) |
| InChIKey | GNEHQBHPSMLRLM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|