C23H29N5O3S — CID 10366764
1-[3-(dimethylamino)propyl]-3-[4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]phenyl]urea (PubChem CID 10366764) has the molecular formula C23H29N5O3S and a molecular weight of 455.58 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-[4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]phenyl]urea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-[4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 10366764 |
| Molecular Formula | C23H29N5O3S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-[4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]phenyl]urea |
| SMILES | CN(C)CCCNC(=O)Nc1ccc(-c2nnc(CSCCOc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C23H29N5O3S/c1-28(2)14-6-13-24-23(29)25-19-11-9-18(10-12-19)22-27-26-21(31-22)17-32-16-15-30-20-7-4-3-5-8-20/h3-5,7-12H,6,13-17H2,1-2H3,(H2,24,25,29) |
| InChIKey | NXQHAFFKQAKDKG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|