C24H31N5O3S — CID 10050361
1-[2-(diethylamino)ethyl]-3-[4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]phenyl]urea (PubChem CID 10050361) has the molecular formula C24H31N5O3S and a molecular weight of 469.61 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-3-[4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]phenyl]urea.
| Compound Name | 1-[2-(diethylamino)ethyl]-3-[4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 10050361 |
| Molecular Formula | C24H31N5O3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-3-[4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]phenyl]urea |
| SMILES | CCN(CC)CCNC(=O)Nc1ccc(-c2nnc(CSCCOc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C24H31N5O3S/c1-3-29(4-2)15-14-25-24(30)26-20-12-10-19(11-13-20)23-28-27-22(32-23)18-33-17-16-31-21-8-6-5-7-9-21/h5-13H,3-4,14-18H2,1-2H3,(H2,25,26,30) |
| InChIKey | NOBNOYZISXSMNC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|