C15H18N2O4S — CID 23009996
3-[2-[(5-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]benzoic acid (PubChem CID 23009996) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 3-[2-[(5-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]benzoic acid.
| Compound Name | 3-[2-[(5-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 23009996 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3-[2-[(5-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]benzoic acid |
| SMILES | CCCCc1nnc(SCCOc2cccc(C(=O)O)c2)o1 |
| InChI | InChI=1S/C15H18N2O4S/c1-2-3-7-13-16-17-15(21-13)22-9-8-20-12-6-4-5-11(10-12)14(18)19/h4-6,10H,2-3,7-9H2,1H3,(H,18,19) |
| InChIKey | WCIWBZMDNWACTP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|