C19H18N2O5S — CID 23010044
3-[2-[[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]ethoxy]benzoic acid (PubChem CID 23010044) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is 3-[2-[[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]ethoxy]benzoic acid.
| Compound Name | 3-[2-[[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 23010044 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 3-[2-[[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]ethoxy]benzoic acid |
| SMILES | COc1ccc(Cc2nnc(SCCOc3cccc(C(=O)O)c3)o2)cc1 |
| InChI | InChI=1S/C19H18N2O5S/c1-24-15-7-5-13(6-8-15)11-17-20-21-19(26-17)27-10-9-25-16-4-2-3-14(12-16)18(22)23/h2-8,12H,9-11H2,1H3,(H,22,23) |
| InChIKey | HTSIDLZBORPJCS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|