C26H34O4 — CID 71777687
1,2-bis(3-hexoxyphenyl)ethane-1,2-dione (PubChem CID 71777687) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is 1,2-bis(3-hexoxyphenyl)ethane-1,2-dione.
| Compound Name | 1,2-bis(3-hexoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 71777687 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 1,2-bis(3-hexoxyphenyl)ethane-1,2-dione |
| SMILES | CCCCCCOc1cccc(C(=O)C(=O)c2cccc(OCCCCCC)c2)c1 |
| InChI | InChI=1S/C26H34O4/c1-3-5-7-9-17-29-23-15-11-13-21(19-23)25(27)26(28)22-14-12-16-24(20-22)30-18-10-8-6-4-2/h11-16,19-20H,3-10,17-18H2,1-2H3 |
| InChIKey | TUOQUVOSOCOHQX-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|