About 3-heptoxybenzohydrazide
3-heptoxybenzohydrazide (PubChem CID 54793165) has the molecular formula C14H22N2O2
and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-heptoxybenzohydrazide.
Molecular Properties
| Compound Name | 3-heptoxybenzohydrazide |
| PubChem CID | 54793165 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 3-heptoxybenzohydrazide |
| SMILES | CCCCCCCOc1cccc(C(=O)NN)c1 |
| InChI | InChI=1S/C14H22N2O2/c1-2-3-4-5-6-10-18-13-9-7-8-12(11-13)14(17)16-15/h7-9,11H,2-6,10,15H2,1H3,(H,16,17) |
| InChIKey | LFKDIWSLHUGOMC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-heptoxybenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-heptoxybenzohydrazide?
The IUPAC name of 3-heptoxybenzohydrazide (CID 54793165) is 3-heptoxybenzohydrazide.
What is the SMILES notation for 3-heptoxybenzohydrazide?
The canonical SMILES for 3-heptoxybenzohydrazide is CCCCCCCOc1cccc(C(=O)NN)c1.
What is the InChIKey of 3-heptoxybenzohydrazide?
The InChIKey is LFKDIWSLHUGOMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2/c1-2-3-4-5-6-10-18-13-9-7-8-12(11-13)14(17)16-15/h7-9,11H,2-6,10,15H2,1H3,(H,16,17).
What are the key properties of 3-heptoxybenzohydrazide?
3-heptoxybenzohydrazide has a molecular weight of 250.34 g/mol, XLogP of 2.64, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-heptoxybenzohydrazide is sourced from PubChem (CID 54793165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).