C22H20N2O3S — CID 58897555
[6-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]naphthalen-2-yl]methanol (PubChem CID 58897555) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is [6-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]naphthalen-2-yl]methanol.
| Compound Name | [6-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]naphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 58897555 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | [6-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]naphthalen-2-yl]methanol |
| SMILES | OCc1ccc2cc(-c3nnc(CSCCOc4ccccc4)o3)ccc2c1 |
| InChI | InChI=1S/C22H20N2O3S/c25-14-16-6-7-18-13-19(9-8-17(18)12-16)22-24-23-21(27-22)15-28-11-10-26-20-4-2-1-3-5-20/h1-9,12-13,25H,10-11,14-15H2 |
| InChIKey | GAMYLDBIQGFUAV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|