C26H30N4O3S — CID 58897585
6-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]-2-(2-piperidin-1-ylethyl)-3H-isoindol-1-one (PubChem CID 58897585) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is 6-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]-2-(2-piperidin-1-ylethyl)-3H-isoindol-1-one.
| Compound Name | 6-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]-2-(2-piperidin-1-ylethyl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 58897585 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 6-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]-2-(2-piperidin-1-ylethyl)-3H-isoindol-1-one |
| SMILES | O=C1c2cc(-c3nnc(CSCCOc4ccccc4)o3)ccc2CN1CCN1CCCCC1 |
| InChI | InChI=1S/C26H30N4O3S/c31-26-23-17-20(9-10-21(23)18-30(26)14-13-29-11-5-2-6-12-29)25-28-27-24(33-25)19-34-16-15-32-22-7-3-1-4-8-22/h1,3-4,7-10,17H,2,5-6,11-16,18-19H2 |
| InChIKey | IIZFRACMKUJMGZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|