C25H30N2O3S — CID 21108835
4-methyl-5-(2-phenoxyethylsulfanylmethyl)-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1,3-oxazole (PubChem CID 21108835) has the molecular formula C25H30N2O3S and a molecular weight of 438.59 g/mol. Its IUPAC name is 4-methyl-5-(2-phenoxyethylsulfanylmethyl)-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1,3-oxazole.
| Compound Name | 4-methyl-5-(2-phenoxyethylsulfanylmethyl)-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 21108835 |
| Molecular Formula | C25H30N2O3S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 4-methyl-5-(2-phenoxyethylsulfanylmethyl)-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1,3-oxazole |
| SMILES | Cc1nc(-c2ccc(OCCN3CCCC3)cc2)oc1CSCCOc1ccccc1 |
| InChI | InChI=1S/C25H30N2O3S/c1-20-24(19-31-18-17-29-22-7-3-2-4-8-22)30-25(26-20)21-9-11-23(12-10-21)28-16-15-27-13-5-6-14-27/h2-4,7-12H,5-6,13-19H2,1H3 |
| InChIKey | VSWJOXGWYKHLKK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|