C26H32N2O3S — CID 10026891
2-(2-phenoxyethylsulfanylmethyl)-5-[4-(3-piperidin-1-ylpropoxy)phenyl]-1,3-oxazole (PubChem CID 10026891) has the molecular formula C26H32N2O3S and a molecular weight of 452.62 g/mol. Its IUPAC name is 2-(2-phenoxyethylsulfanylmethyl)-5-[4-(3-piperidin-1-ylpropoxy)phenyl]-1,3-oxazole.
| Compound Name | 2-(2-phenoxyethylsulfanylmethyl)-5-[4-(3-piperidin-1-ylpropoxy)phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 10026891 |
| Molecular Formula | C26H32N2O3S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 2-(2-phenoxyethylsulfanylmethyl)-5-[4-(3-piperidin-1-ylpropoxy)phenyl]-1,3-oxazole |
| SMILES | c1ccc(OCCSCc2ncc(-c3ccc(OCCCN4CCCCC4)cc3)o2)cc1 |
| InChI | InChI=1S/C26H32N2O3S/c1-3-8-23(9-4-1)30-18-19-32-21-26-27-20-25(31-26)22-10-12-24(13-11-22)29-17-7-16-28-14-5-2-6-15-28/h1,3-4,8-13,20H,2,5-7,14-19,21H2 |
| InChIKey | CZQLRFOIKRGPFY-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|