C24H28N2O3S — CID 21108852
5-(2-phenoxyethylsulfanylmethyl)-3-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1,2-oxazole (PubChem CID 21108852) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is 5-(2-phenoxyethylsulfanylmethyl)-3-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1,2-oxazole.
| Compound Name | 5-(2-phenoxyethylsulfanylmethyl)-3-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 21108852 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 5-(2-phenoxyethylsulfanylmethyl)-3-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1,2-oxazole |
| SMILES | c1ccc(OCCSCc2cc(-c3ccc(OCCN4CCCC4)cc3)no2)cc1 |
| InChI | InChI=1S/C24H28N2O3S/c1-2-6-21(7-3-1)28-16-17-30-19-23-18-24(25-29-23)20-8-10-22(11-9-20)27-15-14-26-12-4-5-13-26/h1-3,6-11,18H,4-5,12-17,19H2 |
| InChIKey | DNYCJTMIVQWWHU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|