C24H29N3O3S — CID 21108652
3-[4-[2-(1-methylpyrrolidin-2-yl)ethoxy]phenyl]-5-(2-phenoxyethylsulfanylmethyl)-1,2,4-oxadiazole (PubChem CID 21108652) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is 3-[4-[2-(1-methylpyrrolidin-2-yl)ethoxy]phenyl]-5-(2-phenoxyethylsulfanylmethyl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-[2-(1-methylpyrrolidin-2-yl)ethoxy]phenyl]-5-(2-phenoxyethylsulfanylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 21108652 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 3-[4-[2-(1-methylpyrrolidin-2-yl)ethoxy]phenyl]-5-(2-phenoxyethylsulfanylmethyl)-1,2,4-oxadiazole |
| SMILES | CN1CCCC1CCOc1ccc(-c2noc(CSCCOc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-27-14-5-6-20(27)13-15-28-22-11-9-19(10-12-22)24-25-23(30-26-24)18-31-17-16-29-21-7-3-2-4-8-21/h2-4,7-12,20H,5-6,13-18H2,1H3 |
| InChIKey | MXZVGAHJJJMTMD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 60.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|