C22H27N3O3S — CID 142831072
N,N-dimethyl-3-[4-[5-(2-phenoxyethylsulfanylmethyl)-1,2,4-oxadiazol-3-yl]phenoxy]propan-1-amine (PubChem CID 142831072) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is N,N-dimethyl-3-[4-[5-(2-phenoxyethylsulfanylmethyl)-1,2,4-oxadiazol-3-yl]phenoxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[4-[5-(2-phenoxyethylsulfanylmethyl)-1,2,4-oxadiazol-3-yl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 142831072 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | N,N-dimethyl-3-[4-[5-(2-phenoxyethylsulfanylmethyl)-1,2,4-oxadiazol-3-yl]phenoxy]propan-1-amine |
| SMILES | CN(C)CCCOc1ccc(-c2noc(CSCCOc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H27N3O3S/c1-25(2)13-6-14-26-20-11-9-18(10-12-20)22-23-21(28-24-22)17-29-16-15-27-19-7-4-3-5-8-19/h3-5,7-12H,6,13-17H2,1-2H3 |
| InChIKey | YASCLPWODVWHKE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 60.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|