C26H32N4O2S — CID 59643561
2-[4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazole (PubChem CID 59643561) has the molecular formula C26H32N4O2S and a molecular weight of 464.64 g/mol. Its IUPAC name is 2-[4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazole.
| Compound Name | 2-[4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 59643561 |
| Molecular Formula | C26H32N4O2S |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 2-[4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazole |
| SMILES | CC1CCCN1C1CCN(c2ccc(-c3nnc(CSCCOc4ccccc4)o3)cc2)C1 |
| InChI | InChI=1S/C26H32N4O2S/c1-20-6-5-14-30(20)23-13-15-29(18-23)22-11-9-21(10-12-22)26-28-27-25(32-26)19-33-17-16-31-24-7-3-2-4-8-24/h2-4,7-12,20,23H,5-6,13-19H2,1H3 |
| InChIKey | AVDXRVLEHSGLFF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|