3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid

C13H8N4O3 — CID 102922684

IUPAC3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid
SMILESO=C(O)c1cccc(-c2nnc(-c3cncnc3)o2)c1
InChIInChI=1S/C13H8N4O3/c18-13(19)9-3-1-2-8(4-9)11-16-17-12(20-11)10-5-14-7-15-6-10/h1-7H,(H,18,19)
InChIKeyITDDSLHEOJJOIF-UHFFFAOYSA-N
MW268.23 g/mol
LogP1.89
Rot. Bonds3

About 3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid

3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid (PubChem CID 102922684) has the molecular formula C13H8N4O3 and a molecular weight of 268.23 g/mol. Its IUPAC name is 3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid.

Molecular Properties

Compound Name3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid
PubChem CID102922684
Molecular FormulaC13H8N4O3
Molecular Weight268.23 g/mol
Exact Mass268.06
IUPAC Name3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid
SMILESO=C(O)c1cccc(-c2nnc(-c3cncnc3)o2)c1
InChIInChI=1S/C13H8N4O3/c18-13(19)9-3-1-2-8(4-9)11-16-17-12(20-11)10-5-14-7-15-6-10/h1-7H,(H,18,19)
InChIKeyITDDSLHEOJJOIF-UHFFFAOYSA-N
XLogP1.89
TPSA102.00 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.23
LogP ≤ 51.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid?
The IUPAC name of 3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid (CID 102922684) is 3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid.
What is the SMILES notation for 3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid?
The canonical SMILES for 3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid is O=C(O)c1cccc(-c2nnc(-c3cncnc3)o2)c1.
What is the InChIKey of 3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid?
The InChIKey is ITDDSLHEOJJOIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N4O3/c18-13(19)9-3-1-2-8(4-9)11-16-17-12(20-11)10-5-14-7-15-6-10/h1-7H,(H,18,19).
What are the key properties of 3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid?
3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid has a molecular weight of 268.23 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-pyrimidin-5-yl-1,3,4-oxadiazol-2-yl)benzoic acid is sourced from PubChem (CID 102922684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).