C21H15N3O5S — CID 171985684
3-[[3-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]sulfonylamino]benzoic acid (PubChem CID 171985684) has the molecular formula C21H15N3O5S and a molecular weight of 421.43 g/mol. Its IUPAC name is 3-[[3-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]sulfonylamino]benzoic acid.
| Compound Name | 3-[[3-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 171985684 |
| Molecular Formula | C21H15N3O5S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 3-[[3-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1cccc(NS(=O)(=O)c2cccc(-c3nnc(-c4ccccc4)o3)c2)c1 |
| InChI | InChI=1S/C21H15N3O5S/c25-21(26)16-9-4-10-17(12-16)24-30(27,28)18-11-5-8-15(13-18)20-23-22-19(29-20)14-6-2-1-3-7-14/h1-13,24H,(H,25,26) |
| InChIKey | ZINMSSREGDALOE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |