C13H9Cl2NO4S — CID 2234493
3-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid (PubChem CID 2234493) has the molecular formula C13H9Cl2NO4S and a molecular weight of 346.19 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid.
| Compound Name | 3-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 2234493 |
| Molecular Formula | C13H9Cl2NO4S |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1cccc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C13H9Cl2NO4S/c14-11-5-4-10(7-12(11)15)21(19,20)16-9-3-1-2-8(6-9)13(17)18/h1-7,16H,(H,17,18) |
| InChIKey | AKPAXFIVLVXWKY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |