C14H11Cl2NO3S — CID 3702970
N-(3-acetylphenyl)-3,4-dichlorobenzenesulfonamide (PubChem CID 3702970) has the molecular formula C14H11Cl2NO3S and a molecular weight of 344.22 g/mol. Its IUPAC name is N-(3-acetylphenyl)-3,4-dichlorobenzenesulfonamide.
| Compound Name | N-(3-acetylphenyl)-3,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 3702970 |
| Molecular Formula | C14H11Cl2NO3S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | N-(3-acetylphenyl)-3,4-dichlorobenzenesulfonamide |
| SMILES | CC(=O)c1cccc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H11Cl2NO3S/c1-9(18)10-3-2-4-11(7-10)17-21(19,20)12-5-6-13(15)14(16)8-12/h2-8,17H,1H3 |
| InChIKey | VQTXGKSMUNKGGO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |