C22H19Cl2N3O4S — CID 24659997
N-(2-benzamidoethyl)-3-[(3,4-dichlorophenyl)sulfonylamino]benzamide (PubChem CID 24659997) has the molecular formula C22H19Cl2N3O4S and a molecular weight of 492.38 g/mol. Its IUPAC name is N-(2-benzamidoethyl)-3-[(3,4-dichlorophenyl)sulfonylamino]benzamide.
| Compound Name | N-(2-benzamidoethyl)-3-[(3,4-dichlorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 24659997 |
| Molecular Formula | C22H19Cl2N3O4S |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | N-(2-benzamidoethyl)-3-[(3,4-dichlorophenyl)sulfonylamino]benzamide |
| SMILES | O=C(NCCNC(=O)c1cccc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H19Cl2N3O4S/c23-19-10-9-18(14-20(19)24)32(30,31)27-17-8-4-7-16(13-17)22(29)26-12-11-25-21(28)15-5-2-1-3-6-15/h1-10,13-14,27H,11-12H2,(H,25,28)(H,26,29) |
| InChIKey | UMPCQNRWXZBSFL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|