C14H12Cl2N2O4S — CID 33102554
3-[(3,4-dichlorophenyl)sulfonylamino]-N-methoxybenzamide (PubChem CID 33102554) has the molecular formula C14H12Cl2N2O4S and a molecular weight of 375.23 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)sulfonylamino]-N-methoxybenzamide.
| Compound Name | 3-[(3,4-dichlorophenyl)sulfonylamino]-N-methoxybenzamide |
|---|---|
| PubChem CID | 33102554 |
| Molecular Formula | C14H12Cl2N2O4S |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)sulfonylamino]-N-methoxybenzamide |
| SMILES | CONC(=O)c1cccc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H12Cl2N2O4S/c1-22-17-14(19)9-3-2-4-10(7-9)18-23(20,21)11-5-6-12(15)13(16)8-11/h2-8,18H,1H3,(H,17,19) |
| InChIKey | LXHVWHNEDSPZMX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|