C13H11Cl2N3O3S — CID 100657146
N-(3,4-dichlorophenyl)-3-(hydrazinecarbonyl)benzenesulfonamide (PubChem CID 100657146) has the molecular formula C13H11Cl2N3O3S and a molecular weight of 360.22 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-(hydrazinecarbonyl)benzenesulfonamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-(hydrazinecarbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 100657146 |
| Molecular Formula | C13H11Cl2N3O3S |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-(hydrazinecarbonyl)benzenesulfonamide |
| SMILES | NNC(=O)c1cccc(S(=O)(=O)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C13H11Cl2N3O3S/c14-11-5-4-9(7-12(11)15)18-22(20,21)10-3-1-2-8(6-10)13(19)17-16/h1-7,18H,16H2,(H,17,19) |
| InChIKey | YEWYFSARZONTBN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|