C21H17Cl2N3O4S — CID 24635607
3-[(3,4-dichlorophenyl)sulfonylamino]-N-[4-(methylcarbamoyl)phenyl]benzamide (PubChem CID 24635607) has the molecular formula C21H17Cl2N3O4S and a molecular weight of 478.36 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)sulfonylamino]-N-[4-(methylcarbamoyl)phenyl]benzamide.
| Compound Name | 3-[(3,4-dichlorophenyl)sulfonylamino]-N-[4-(methylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 24635607 |
| Molecular Formula | C21H17Cl2N3O4S |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 477.03 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)sulfonylamino]-N-[4-(methylcarbamoyl)phenyl]benzamide |
| SMILES | CNC(=O)c1ccc(NC(=O)c2cccc(NS(=O)(=O)c3ccc(Cl)c(Cl)c3)c2)cc1 |
| InChI | InChI=1S/C21H17Cl2N3O4S/c1-24-20(27)13-5-7-15(8-6-13)25-21(28)14-3-2-4-16(11-14)26-31(29,30)17-9-10-18(22)19(23)12-17/h2-12,26H,1H3,(H,24,27)(H,25,28) |
| InChIKey | JWUOLYOKCUWJRV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |