C16H16Cl2N2O3S — CID 27648381
3-[(3,4-dichlorophenyl)sulfonylamino]-N-propan-2-ylbenzamide (PubChem CID 27648381) has the molecular formula C16H16Cl2N2O3S and a molecular weight of 387.30 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)sulfonylamino]-N-propan-2-ylbenzamide.
| Compound Name | 3-[(3,4-dichlorophenyl)sulfonylamino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 27648381 |
| Molecular Formula | C16H16Cl2N2O3S |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)sulfonylamino]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)C1=CC(=CC=C1)NS(=O)(=O)C2=CC(=C(C=C2)Cl)Cl |
| InChI | InChI=1S/C16H16Cl2N2O3S/c1-10(2)19-16(21)11-4-3-5-12(8-11)20-24(22,23)13-6-7-14(17)15(18)9-13/h3-10,20H,1-2H3,(H,19,21) |
| InChIKey | UAJBDPBXAJRDDQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | 536 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |