C21H17ClFN3O4S — CID 30910349
2-chloro-5-[(4-fluorophenyl)sulfamoyl]-N-[4-(methylcarbamoyl)phenyl]benzamide (PubChem CID 30910349) has the molecular formula C21H17ClFN3O4S and a molecular weight of 461.90 g/mol. Its IUPAC name is 2-chloro-5-[(4-fluorophenyl)sulfamoyl]-N-[4-(methylcarbamoyl)phenyl]benzamide.
| Compound Name | 2-chloro-5-[(4-fluorophenyl)sulfamoyl]-N-[4-(methylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 30910349 |
| Molecular Formula | C21H17ClFN3O4S |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 2-chloro-5-[(4-fluorophenyl)sulfamoyl]-N-[4-(methylcarbamoyl)phenyl]benzamide |
| SMILES | CNC(=O)c1ccc(NC(=O)c2cc(S(=O)(=O)Nc3ccc(F)cc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H17ClFN3O4S/c1-24-20(27)13-2-6-15(7-3-13)25-21(28)18-12-17(10-11-19(18)22)31(29,30)26-16-8-4-14(23)5-9-16/h2-12,26H,1H3,(H,24,27)(H,25,28) |
| InChIKey | RZFLEJHEPCOXBD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |