C16H14ClFN2O3S — CID 27537411
2-chloro-N-cyclopropyl-5-[(4-fluorophenyl)sulfamoyl]benzamide (PubChem CID 27537411) has the molecular formula C16H14ClFN2O3S and a molecular weight of 368.82 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-5-[(4-fluorophenyl)sulfamoyl]benzamide.
| Compound Name | 2-chloro-N-cyclopropyl-5-[(4-fluorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 27537411 |
| Molecular Formula | C16H14ClFN2O3S |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 2-chloro-N-cyclopropyl-5-[(4-fluorophenyl)sulfamoyl]benzamide |
| SMILES | O=C(NC1CC1)c1cc(S(=O)(=O)Nc2ccc(F)cc2)ccc1Cl |
| InChI | InChI=1S/C16H14ClFN2O3S/c17-15-8-7-13(9-14(15)16(21)19-11-5-6-11)24(22,23)20-12-3-1-10(18)2-4-12/h1-4,7-9,11,20H,5-6H2,(H,19,21) |
| InChIKey | IEHSWHMMTHLPOL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |